C24H26 — CID 5378828
[(3E,7E)-2,9-dimethyl-7-phenyldeca-3,7-dien-5-yn-4-yl]benzene (PubChem CID 5378828) has the molecular formula C24H26 and a molecular weight of 314.47 g/mol. Its IUPAC name is [(3E,7E)-2,9-dimethyl-7-phenyldeca-3,7-dien-5-yn-4-yl]benzene.
| Compound Name | [(3E,7E)-2,9-dimethyl-7-phenyldeca-3,7-dien-5-yn-4-yl]benzene |
|---|---|
| PubChem CID | 5378828 |
| Molecular Formula | C24H26 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | [(3E,7E)-2,9-dimethyl-7-phenyldeca-3,7-dien-5-yn-4-yl]benzene |
| SMILES | CC(C)/C=C(/C#C/C(=C/C(C)C)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H26/c1-19(2)17-23(21-11-7-5-8-12-21)15-16-24(18-20(3)4)22-13-9-6-10-14-22/h5-14,17-20H,1-4H3/b23-17-,24-18- |
| InChIKey | FSGFLPJTILQZCT-BOYKQRMESA-N |
| XLogP | 6.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|