C26H22N2 — CID 6197723
(Z)-4-methyl-2,5,6-triphenylhept-2-enedinitrile (PubChem CID 6197723) has the molecular formula C26H22N2 and a molecular weight of 362.48 g/mol. Its IUPAC name is (Z)-4-methyl-2,5,6-triphenylhept-2-enedinitrile.
| Compound Name | (Z)-4-methyl-2,5,6-triphenylhept-2-enedinitrile |
|---|---|
| PubChem CID | 6197723 |
| Molecular Formula | C26H22N2 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | (Z)-4-methyl-2,5,6-triphenylhept-2-enedinitrile |
| SMILES | CC(/C=C(\C#N)c1ccccc1)C(c1ccccc1)C(C#N)c1ccccc1 |
| InChI | InChI=1S/C26H22N2/c1-20(17-24(18-27)21-11-5-2-6-12-21)26(23-15-9-4-10-16-23)25(19-28)22-13-7-3-8-14-22/h2-17,20,25-26H,1H3/b24-17+ |
| InChIKey | KIDPSLOZAJOXQR-JJIBRWJFSA-N |
| XLogP | 6.32 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|