C18H14N2 — CID 67423079
2,5-diphenylhex-2-enedinitrile (PubChem CID 67423079) has the molecular formula C18H14N2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 2,5-diphenylhex-2-enedinitrile.
| Compound Name | 2,5-diphenylhex-2-enedinitrile |
|---|---|
| PubChem CID | 67423079 |
| Molecular Formula | C18H14N2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 2,5-diphenylhex-2-enedinitrile |
| SMILES | N#CC(=CCC(C#N)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H14N2/c19-13-17(15-7-3-1-4-8-15)11-12-18(14-20)16-9-5-2-6-10-16/h1-11,18H,12H2 |
| InChIKey | SHGBXCLNMZMACS-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|