About ethane;2-phenylbutanenitrile
ethane;2-phenylbutanenitrile (PubChem CID 91343198) has the molecular formula C12H17N
and a molecular weight of 175.27 g/mol. Its IUPAC name is ethane;2-phenylbutanenitrile.
Molecular Properties
| Compound Name | ethane;2-phenylbutanenitrile |
| PubChem CID | 91343198 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | ethane;2-phenylbutanenitrile |
| SMILES | CC.CCC(C#N)c1ccccc1 |
| InChI | InChI=1S/C10H11N.C2H6/c1-2-9(8-11)10-6-4-3-5-7-10;1-2/h3-7,9H,2H2,1H3;1-2H3 |
| InChIKey | NFEFVZQOOFNOHA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-phenylbutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-phenylbutanenitrile?
The IUPAC name of ethane;2-phenylbutanenitrile (CID 91343198) is ethane;2-phenylbutanenitrile.
What is the SMILES notation for ethane;2-phenylbutanenitrile?
The canonical SMILES for ethane;2-phenylbutanenitrile is CC.CCC(C#N)c1ccccc1.
What is the InChIKey of ethane;2-phenylbutanenitrile?
The InChIKey is NFEFVZQOOFNOHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N.C2H6/c1-2-9(8-11)10-6-4-3-5-7-10;1-2/h3-7,9H,2H2,1H3;1-2H3.
What are the key properties of ethane;2-phenylbutanenitrile?
ethane;2-phenylbutanenitrile has a molecular weight of 175.27 g/mol, XLogP of 3.73, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-phenylbutanenitrile is sourced from PubChem (CID 91343198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).