C14H11N — CID 20795369
6-phenylocta-2,4-diynenitrile (PubChem CID 20795369) has the molecular formula C14H11N and a molecular weight of 193.25 g/mol. Its IUPAC name is 6-phenylocta-2,4-diynenitrile.
| Compound Name | 6-phenylocta-2,4-diynenitrile |
|---|---|
| PubChem CID | 20795369 |
| Molecular Formula | C14H11N |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 6-phenylocta-2,4-diynenitrile |
| SMILES | CCC(C#CC#CC#N)c1ccccc1 |
| InChI | InChI=1S/C14H11N/c1-2-13(9-7-4-8-12-15)14-10-5-3-6-11-14/h3,5-6,10-11,13H,2H2,1H3 |
| InChIKey | RRGBZCKRLHLCBL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|