C14H19NO2 — CID 13486179
4,4-diethoxy-2-phenylbutanenitrile (PubChem CID 13486179) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 4,4-diethoxy-2-phenylbutanenitrile.
| Compound Name | 4,4-diethoxy-2-phenylbutanenitrile |
|---|---|
| PubChem CID | 13486179 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 4,4-diethoxy-2-phenylbutanenitrile |
| SMILES | CCOC(CC(C#N)c1ccccc1)OCC |
| InChI | InChI=1S/C14H19NO2/c1-3-16-14(17-4-2)10-13(11-15)12-8-6-5-7-9-12/h5-9,13-14H,3-4,10H2,1-2H3 |
| InChIKey | HWTARGPLTRBZOJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|