C15H24O3 — CID 3754405
1,3,3-triethoxypropylbenzene (PubChem CID 3754405) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is 1,3,3-triethoxypropylbenzene.
| Compound Name | 1,3,3-triethoxypropylbenzene |
|---|---|
| PubChem CID | 3754405 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | 1,3,3-triethoxypropylbenzene |
| SMILES | CCOC(CC(OCC)c1ccccc1)OCC |
| InChI | InChI=1S/C15H24O3/c1-4-16-14(13-10-8-7-9-11-13)12-15(17-5-2)18-6-3/h7-11,14-15H,4-6,12H2,1-3H3 |
| InChIKey | VTQQBAYGEWEYQX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|