C21H27NO2 — CID 39844404
4-[(1S,3S)-3-ethoxy-1,3-diphenylpropyl]morpholine (PubChem CID 39844404) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is 4-[(1S,3S)-3-ethoxy-1,3-diphenylpropyl]morpholine.
| Compound Name | 4-[(1S,3S)-3-ethoxy-1,3-diphenylpropyl]morpholine |
|---|---|
| PubChem CID | 39844404 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 4-[(1S,3S)-3-ethoxy-1,3-diphenylpropyl]morpholine |
| SMILES | CCO[C@@H](C[C@@H](c1ccccc1)N1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C21H27NO2/c1-2-24-21(19-11-7-4-8-12-19)17-20(18-9-5-3-6-10-18)22-13-15-23-16-14-22/h3-12,20-21H,2,13-17H2,1H3/t20-,21-/m0/s1 |
| InChIKey | BOWMTRHOSGVIPZ-SFTDATJTSA-N |
| XLogP | 4.23 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |