N-ethyl-2-morpholin-4-yl-2-phenylethanamine;molecular hydrogen

C14H24N2O — CID 144767437

IUPACN-ethyl-2-morpholin-4-yl-2-phenylethanamine;molecular hydrogen
SMILESCCNCC(c1ccccc1)N1CCOCC1.[H][H]
InChIInChI=1S/C14H22N2O.H2/c1-2-15-12-14(13-6-4-3-5-7-13)16-8-10-17-11-9-16;/h3-7,14-15H,2,8-12H2,1H3;1H
InChIKeyXRZQJLORLGMYDG-UHFFFAOYSA-N
MW236.36 g/mol
LogP1.92
Rot. Bonds5

About N-ethyl-2-morpholin-4-yl-2-phenylethanamine;molecular hydrogen

N-ethyl-2-morpholin-4-yl-2-phenylethanamine;molecular hydrogen (PubChem CID 144767437) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is N-ethyl-2-morpholin-4-yl-2-phenylethanamine;molecular hydrogen.

Molecular Properties

Compound NameN-ethyl-2-morpholin-4-yl-2-phenylethanamine;molecular hydrogen
PubChem CID144767437
Molecular FormulaC14H24N2O
Molecular Weight236.36 g/mol
Exact Mass236.19
IUPAC NameN-ethyl-2-morpholin-4-yl-2-phenylethanamine;molecular hydrogen
SMILESCCNCC(c1ccccc1)N1CCOCC1.[H][H]
InChIInChI=1S/C14H22N2O.H2/c1-2-15-12-14(13-6-4-3-5-7-13)16-8-10-17-11-9-16;/h3-7,14-15H,2,8-12H2,1H3;1H
InChIKeyXRZQJLORLGMYDG-UHFFFAOYSA-N
XLogP1.92
TPSA24.50 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.36
LogP ≤ 51.92
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze N-ethyl-2-morpholin-4-yl-2-phenylethanamine;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-ethyl-2-morpholin-4-yl-2-phenylethanamine;molecular hydrogen?
The IUPAC name of N-ethyl-2-morpholin-4-yl-2-phenylethanamine;molecular hydrogen (CID 144767437) is N-ethyl-2-morpholin-4-yl-2-phenylethanamine;molecular hydrogen.
What is the SMILES notation for N-ethyl-2-morpholin-4-yl-2-phenylethanamine;molecular hydrogen?
The canonical SMILES for N-ethyl-2-morpholin-4-yl-2-phenylethanamine;molecular hydrogen is CCNCC(c1ccccc1)N1CCOCC1.[H][H].
What is the InChIKey of N-ethyl-2-morpholin-4-yl-2-phenylethanamine;molecular hydrogen?
The InChIKey is XRZQJLORLGMYDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O.H2/c1-2-15-12-14(13-6-4-3-5-7-13)16-8-10-17-11-9-16;/h3-7,14-15H,2,8-12H2,1H3;1H.
What are the key properties of N-ethyl-2-morpholin-4-yl-2-phenylethanamine;molecular hydrogen?
N-ethyl-2-morpholin-4-yl-2-phenylethanamine;molecular hydrogen has a molecular weight of 236.36 g/mol, XLogP of 1.92, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2-morpholin-4-yl-2-phenylethanamine;molecular hydrogen is sourced from PubChem (CID 144767437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).