C16H24N2 — CID 114413305
N-ethyl-2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-phenylethanamine (PubChem CID 114413305) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is N-ethyl-2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-phenylethanamine.
| Compound Name | N-ethyl-2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-phenylethanamine |
|---|---|
| PubChem CID | 114413305 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | N-ethyl-2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-2-phenylethanamine |
| SMILES | CCNCC(c1ccccc1)N1CC=C(C)CC1 |
| InChI | InChI=1S/C16H24N2/c1-3-17-13-16(15-7-5-4-6-8-15)18-11-9-14(2)10-12-18/h4-9,16-17H,3,10-13H2,1-2H3 |
| InChIKey | NMTSPPFYCQIQNE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|