C14H28N2 — CID 114413146
2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-N-propylpentan-1-amine (PubChem CID 114413146) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is 2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-N-propylpentan-1-amine.
| Compound Name | 2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-N-propylpentan-1-amine |
|---|---|
| PubChem CID | 114413146 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | 2-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-N-propylpentan-1-amine |
| SMILES | CCCNCC(CCC)N1CC=C(C)CC1 |
| InChI | InChI=1S/C14H28N2/c1-4-6-14(12-15-9-5-2)16-10-7-13(3)8-11-16/h7,14-15H,4-6,8-12H2,1-3H3 |
| InChIKey | MECUZCSADUEKGA-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|