C11H23N — CID 166546302
ethane;4-methyl-1-propan-2-yl-3,6-dihydro-2H-pyridine (PubChem CID 166546302) has the molecular formula C11H23N and a molecular weight of 169.31 g/mol. Its IUPAC name is ethane;4-methyl-1-propan-2-yl-3,6-dihydro-2H-pyridine.
| Compound Name | ethane;4-methyl-1-propan-2-yl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 166546302 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | ethane;4-methyl-1-propan-2-yl-3,6-dihydro-2H-pyridine |
| SMILES | CC.CC1=CCN(C(C)C)CC1 |
| InChI | InChI=1S/C9H17N.C2H6/c1-8(2)10-6-4-9(3)5-7-10;1-2/h4,8H,5-7H2,1-3H3;1-2H3 |
| InChIKey | BUOKEXZIACNGST-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|