About 4-methyl-3,6-dihydro-2H-pyridine-1-sulfinic acid
4-methyl-3,6-dihydro-2H-pyridine-1-sulfinic acid (PubChem CID 129136645) has the molecular formula C6H11NO2S
and a molecular weight of 161.23 g/mol. Its IUPAC name is 4-methyl-3,6-dihydro-2H-pyridine-1-sulfinic acid.
Molecular Properties
| Compound Name | 4-methyl-3,6-dihydro-2H-pyridine-1-sulfinic acid |
| PubChem CID | 129136645 |
| Molecular Formula | C6H11NO2S |
| Molecular Weight | 161.23 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | 4-methyl-3,6-dihydro-2H-pyridine-1-sulfinic acid |
| SMILES | CC1=CCN(S(=O)O)CC1 |
| InChI | InChI=1S/C6H11NO2S/c1-6-2-4-7(5-3-6)10(8)9/h2H,3-5H2,1H3,(H,8,9) |
| InChIKey | ZRTPMZSABCRCPE-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.23 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-3,6-dihydro-2H-pyridine-1-sulfinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3,6-dihydro-2H-pyridine-1-sulfinic acid?
The IUPAC name of 4-methyl-3,6-dihydro-2H-pyridine-1-sulfinic acid (CID 129136645) is 4-methyl-3,6-dihydro-2H-pyridine-1-sulfinic acid.
What is the SMILES notation for 4-methyl-3,6-dihydro-2H-pyridine-1-sulfinic acid?
The canonical SMILES for 4-methyl-3,6-dihydro-2H-pyridine-1-sulfinic acid is CC1=CCN(S(=O)O)CC1.
What is the InChIKey of 4-methyl-3,6-dihydro-2H-pyridine-1-sulfinic acid?
The InChIKey is ZRTPMZSABCRCPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2S/c1-6-2-4-7(5-3-6)10(8)9/h2H,3-5H2,1H3,(H,8,9).
What are the key properties of 4-methyl-3,6-dihydro-2H-pyridine-1-sulfinic acid?
4-methyl-3,6-dihydro-2H-pyridine-1-sulfinic acid has a molecular weight of 161.23 g/mol, XLogP of 0.78, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3,6-dihydro-2H-pyridine-1-sulfinic acid is sourced from PubChem (CID 129136645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).