C9H14ClNO — CID 93494250
(2S)-2-chloro-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)propan-1-one (PubChem CID 93494250) has the molecular formula C9H14ClNO and a molecular weight of 187.67 g/mol. Its IUPAC name is (2S)-2-chloro-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)propan-1-one.
| Compound Name | (2S)-2-chloro-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 93494250 |
| Molecular Formula | C9H14ClNO |
| Molecular Weight | 187.67 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | (2S)-2-chloro-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)propan-1-one |
| SMILES | CC1=CCN(C(=O)[C@H](C)Cl)CC1 |
| InChI | InChI=1S/C9H14ClNO/c1-7-3-5-11(6-4-7)9(12)8(2)10/h3,8H,4-6H2,1-2H3/t8-/m0/s1 |
| InChIKey | DPAUZDMKVYXFLY-QMMMGPOBSA-N |
| XLogP | 1.79 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.67 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|