C10H16BrNO — CID 114408480
2-bromo-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)butan-1-one (PubChem CID 114408480) has the molecular formula C10H16BrNO and a molecular weight of 246.15 g/mol. Its IUPAC name is 2-bromo-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)butan-1-one.
| Compound Name | 2-bromo-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 114408480 |
| Molecular Formula | C10H16BrNO |
| Molecular Weight | 246.15 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 2-bromo-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)butan-1-one |
| SMILES | CCC(Br)C(=O)N1CC=C(C)CC1 |
| InChI | InChI=1S/C10H16BrNO/c1-3-9(11)10(13)12-6-4-8(2)5-7-12/h4,9H,3,5-7H2,1-2H3 |
| InChIKey | GKDFCBAQSKHQDG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.15 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|