C17H36N2O — CID 145380354
ethane;4-methyl-N,N-di(propan-2-yl)-3,6-dihydro-2H-pyridine-1-carboxamide (PubChem CID 145380354) has the molecular formula C17H36N2O and a molecular weight of 284.49 g/mol. Its IUPAC name is ethane;4-methyl-N,N-di(propan-2-yl)-3,6-dihydro-2H-pyridine-1-carboxamide.
| Compound Name | ethane;4-methyl-N,N-di(propan-2-yl)-3,6-dihydro-2H-pyridine-1-carboxamide |
|---|---|
| PubChem CID | 145380354 |
| Molecular Formula | C17H36N2O |
| Molecular Weight | 284.49 g/mol |
| Exact Mass | 284.28 |
| IUPAC Name | ethane;4-methyl-N,N-di(propan-2-yl)-3,6-dihydro-2H-pyridine-1-carboxamide |
| SMILES | CC.CC.CC1=CCN(C(=O)N(C(C)C)C(C)C)CC1 |
| InChI | InChI=1S/C13H24N2O.2C2H6/c1-10(2)15(11(3)4)13(16)14-8-6-12(5)7-9-14;2*1-2/h6,10-11H,7-9H2,1-5H3;2*1-2H3 |
| InChIKey | SSFWQAYMAUUUEO-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.49 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|