C9H10F3NO2 — CID 71114237
3,3,3-trifluoro-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)propane-1,2-dione (PubChem CID 71114237) has the molecular formula C9H10F3NO2 and a molecular weight of 221.18 g/mol. Its IUPAC name is 3,3,3-trifluoro-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)propane-1,2-dione.
| Compound Name | 3,3,3-trifluoro-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)propane-1,2-dione |
|---|---|
| PubChem CID | 71114237 |
| Molecular Formula | C9H10F3NO2 |
| Molecular Weight | 221.18 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 3,3,3-trifluoro-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)propane-1,2-dione |
| SMILES | CC1=CCN(C(=O)C(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C9H10F3NO2/c1-6-2-4-13(5-3-6)8(15)7(14)9(10,11)12/h2H,3-5H2,1H3 |
| InChIKey | VZAISDNPWONESU-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.18 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|