C11H18N2O2S — CID 144802030
(4-methyl-3,6-dihydro-2H-pyridin-1-yl)-(1-oxo-1,4-thiazinan-4-yl)methanone (PubChem CID 144802030) has the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. Its IUPAC name is (4-methyl-3,6-dihydro-2H-pyridin-1-yl)-(1-oxo-1,4-thiazinan-4-yl)methanone.
| Compound Name | (4-methyl-3,6-dihydro-2H-pyridin-1-yl)-(1-oxo-1,4-thiazinan-4-yl)methanone |
|---|---|
| PubChem CID | 144802030 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | (4-methyl-3,6-dihydro-2H-pyridin-1-yl)-(1-oxo-1,4-thiazinan-4-yl)methanone |
| SMILES | CC1=CCN(C(=O)N2CCS(=O)CC2)CC1 |
| InChI | InChI=1S/C11H18N2O2S/c1-10-2-4-12(5-3-10)11(14)13-6-8-16(15)9-7-13/h2H,3-9H2,1H3 |
| InChIKey | QWOXKKMGHPFIFH-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|