C12H24N2O — CID 143657625
2-(dimethylamino)-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)ethanone;ethane (PubChem CID 143657625) has the molecular formula C12H24N2O and a molecular weight of 212.34 g/mol. Its IUPAC name is 2-(dimethylamino)-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)ethanone;ethane.
| Compound Name | 2-(dimethylamino)-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)ethanone;ethane |
|---|---|
| PubChem CID | 143657625 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | 2-(dimethylamino)-1-(4-methyl-3,6-dihydro-2H-pyridin-1-yl)ethanone;ethane |
| SMILES | CC.CC1=CCN(C(=O)CN(C)C)CC1 |
| InChI | InChI=1S/C10H18N2O.C2H6/c1-9-4-6-12(7-5-9)10(13)8-11(2)3;1-2/h4H,5-8H2,1-3H3;1-2H3 |
| InChIKey | ISCQULJWZIBCTM-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|