C9H16N2O — CID 91175888
1-(3,6-dihydro-2H-pyridin-1-yl)-2-(dimethylamino)ethanone (PubChem CID 91175888) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is 1-(3,6-dihydro-2H-pyridin-1-yl)-2-(dimethylamino)ethanone.
| Compound Name | 1-(3,6-dihydro-2H-pyridin-1-yl)-2-(dimethylamino)ethanone |
|---|---|
| PubChem CID | 91175888 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 1-(3,6-dihydro-2H-pyridin-1-yl)-2-(dimethylamino)ethanone |
| SMILES | CN(C)CC(=O)N1CC=CCC1 |
| InChI | InChI=1S/C9H16N2O/c1-10(2)8-9(12)11-6-4-3-5-7-11/h3-4H,5-8H2,1-2H3 |
| InChIKey | GRCIEQUQZJMNNW-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|