C11H17NO3 — CID 114408018
4-(3,6-dihydro-2H-pyridin-1-yl)-2,2-dimethyl-4-oxobutanoic acid (PubChem CID 114408018) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 4-(3,6-dihydro-2H-pyridin-1-yl)-2,2-dimethyl-4-oxobutanoic acid.
| Compound Name | 4-(3,6-dihydro-2H-pyridin-1-yl)-2,2-dimethyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 114408018 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 4-(3,6-dihydro-2H-pyridin-1-yl)-2,2-dimethyl-4-oxobutanoic acid |
| SMILES | CC(C)(CC(=O)N1CC=CCC1)C(=O)O |
| InChI | InChI=1S/C11H17NO3/c1-11(2,10(14)15)8-9(13)12-6-4-3-5-7-12/h3-4H,5-8H2,1-2H3,(H,14,15) |
| InChIKey | SYJCPKAWUVVNAA-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|