C8H12ClNO — CID 93494142
(2R)-2-chloro-1-(3,6-dihydro-2H-pyridin-1-yl)propan-1-one (PubChem CID 93494142) has the molecular formula C8H12ClNO and a molecular weight of 173.64 g/mol. Its IUPAC name is (2R)-2-chloro-1-(3,6-dihydro-2H-pyridin-1-yl)propan-1-one.
| Compound Name | (2R)-2-chloro-1-(3,6-dihydro-2H-pyridin-1-yl)propan-1-one |
|---|---|
| PubChem CID | 93494142 |
| Molecular Formula | C8H12ClNO |
| Molecular Weight | 173.64 g/mol |
| Exact Mass | 173.06 |
| IUPAC Name | (2R)-2-chloro-1-(3,6-dihydro-2H-pyridin-1-yl)propan-1-one |
| SMILES | C[C@@H](Cl)C(=O)N1CC=CCC1 |
| InChI | InChI=1S/C8H12ClNO/c1-7(9)8(11)10-5-3-2-4-6-10/h2-3,7H,4-6H2,1H3/t7-/m1/s1 |
| InChIKey | OFQSOPCSNDRSCG-SSDOTTSWSA-N |
| XLogP | 1.40 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.64 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|