C10H21N — CID 178031639
1,4-dimethyl-3,6-dihydro-2H-pyridine;propane (PubChem CID 178031639) has the molecular formula C10H21N and a molecular weight of 155.28 g/mol. Its IUPAC name is 1,4-dimethyl-3,6-dihydro-2H-pyridine;propane.
| Compound Name | 1,4-dimethyl-3,6-dihydro-2H-pyridine;propane |
|---|---|
| PubChem CID | 178031639 |
| Molecular Formula | C10H21N |
| Molecular Weight | 155.28 g/mol |
| Exact Mass | 155.17 |
| IUPAC Name | 1,4-dimethyl-3,6-dihydro-2H-pyridine;propane |
| SMILES | CC1=CCN(C)CC1.CCC |
| InChI | InChI=1S/C7H13N.C3H8/c1-7-3-5-8(2)6-4-7;1-3-2/h3H,4-6H2,1-2H3;3H2,1-2H3 |
| InChIKey | AMIZRLOOMWTOET-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.28 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|