C9H16IN — CID 3056866
1-methyl-1-prop-2-enyl-3,6-dihydro-2H-pyridin-1-ium iodide (PubChem CID 3056866) has the molecular formula C9H16IN and a molecular weight of 265.14 g/mol. Its IUPAC name is 1-methyl-1-prop-2-enyl-3,6-dihydro-2H-pyridin-1-ium iodide.
| Compound Name | 1-methyl-1-prop-2-enyl-3,6-dihydro-2H-pyridin-1-ium iodide |
|---|---|
| PubChem CID | 3056866 |
| Molecular Formula | C9H16IN |
| Molecular Weight | 265.14 g/mol |
| Exact Mass | 265.03 |
| IUPAC Name | 1-methyl-1-prop-2-enyl-3,6-dihydro-2H-pyridin-1-ium iodide |
| SMILES | C=CC[N+]1(C)CC=CCC1.[I-] |
| InChI | InChI=1S/C9H16N.HI/c1-3-7-10(2)8-5-4-6-9-10;/h3-5H,1,6-9H2,2H3;1H/q+1;/p-1 |
| InChIKey | JPOSBCKXAIPNMJ-UHFFFAOYSA-M |
| XLogP | -1.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.14 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|