About (2E)-N,N-diethylocta-2,7-dien-1-amine
(2E)-N,N-diethylocta-2,7-dien-1-amine (PubChem CID 5365246) has the molecular formula C12H23N
and a molecular weight of 181.32 g/mol. Its IUPAC name is (2E)-N,N-diethylocta-2,7-dien-1-amine.
Molecular Properties
| Compound Name | (2E)-N,N-diethylocta-2,7-dien-1-amine |
| PubChem CID | 5365246 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | (2E)-N,N-diethylocta-2,7-dien-1-amine |
| SMILES | C=CCCC/C=C/CN(CC)CC |
| InChI | InChI=1S/C12H23N/c1-4-7-8-9-10-11-12-13(5-2)6-3/h4,10-11H,1,5-9,12H2,2-3H3/b11-10+ |
| InChIKey | ZDIDSJWITLGYFN-ZHACJKMWSA-N |
| XLogP | 3.24 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2E)-N,N-diethylocta-2,7-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-N,N-diethylocta-2,7-dien-1-amine?
The IUPAC name of (2E)-N,N-diethylocta-2,7-dien-1-amine (CID 5365246) is (2E)-N,N-diethylocta-2,7-dien-1-amine.
What is the SMILES notation for (2E)-N,N-diethylocta-2,7-dien-1-amine?
The canonical SMILES for (2E)-N,N-diethylocta-2,7-dien-1-amine is C=CCCC/C=C/CN(CC)CC.
What is the InChIKey of (2E)-N,N-diethylocta-2,7-dien-1-amine?
The InChIKey is ZDIDSJWITLGYFN-ZHACJKMWSA-N. The full InChI is InChI=1S/C12H23N/c1-4-7-8-9-10-11-12-13(5-2)6-3/h4,10-11H,1,5-9,12H2,2-3H3/b11-10+.
What are the key properties of (2E)-N,N-diethylocta-2,7-dien-1-amine?
(2E)-N,N-diethylocta-2,7-dien-1-amine has a molecular weight of 181.32 g/mol, XLogP of 3.24, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-N,N-diethylocta-2,7-dien-1-amine is sourced from PubChem (CID 5365246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).