C8H11N — CID 10443130
4-ethynyl-1-methyl-3,6-dihydro-2H-pyridine (PubChem CID 10443130) has the molecular formula C8H11N and a molecular weight of 121.18 g/mol. Its IUPAC name is 4-ethynyl-1-methyl-3,6-dihydro-2H-pyridine.
| Compound Name | 4-ethynyl-1-methyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 10443130 |
| Molecular Formula | C8H11N |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.09 |
| IUPAC Name | 4-ethynyl-1-methyl-3,6-dihydro-2H-pyridine |
| SMILES | C#CC1=CCN(C)CC1 |
| InChI | InChI=1S/C8H11N/c1-3-8-4-6-9(2)7-5-8/h1,4H,5-7H2,2H3 |
| InChIKey | AHPYFQGQOJASKP-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|