About 5-fluoro-1-pent-4-ynyl-3,6-dihydro-2H-pyridine
5-fluoro-1-pent-4-ynyl-3,6-dihydro-2H-pyridine (PubChem CID 130614205) has the molecular formula C10H14FN
and a molecular weight of 167.23 g/mol. Its IUPAC name is 5-fluoro-1-pent-4-ynyl-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 5-fluoro-1-pent-4-ynyl-3,6-dihydro-2H-pyridine |
| PubChem CID | 130614205 |
| Molecular Formula | C10H14FN |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 5-fluoro-1-pent-4-ynyl-3,6-dihydro-2H-pyridine |
| SMILES | C#CCCCN1CCC=C(F)C1 |
| InChI | InChI=1S/C10H14FN/c1-2-3-4-7-12-8-5-6-10(11)9-12/h1,6H,3-5,7-9H2 |
| InChIKey | NWKAQWYIKSBLKN-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-1-pent-4-ynyl-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-1-pent-4-ynyl-3,6-dihydro-2H-pyridine?
The IUPAC name of 5-fluoro-1-pent-4-ynyl-3,6-dihydro-2H-pyridine (CID 130614205) is 5-fluoro-1-pent-4-ynyl-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 5-fluoro-1-pent-4-ynyl-3,6-dihydro-2H-pyridine?
The canonical SMILES for 5-fluoro-1-pent-4-ynyl-3,6-dihydro-2H-pyridine is C#CCCCN1CCC=C(F)C1.
What is the InChIKey of 5-fluoro-1-pent-4-ynyl-3,6-dihydro-2H-pyridine?
The InChIKey is NWKAQWYIKSBLKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14FN/c1-2-3-4-7-12-8-5-6-10(11)9-12/h1,6H,3-5,7-9H2.
What are the key properties of 5-fluoro-1-pent-4-ynyl-3,6-dihydro-2H-pyridine?
5-fluoro-1-pent-4-ynyl-3,6-dihydro-2H-pyridine has a molecular weight of 167.23 g/mol, XLogP of 1.96, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-1-pent-4-ynyl-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 130614205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).