C9H16BrN — CID 117205525
4-(bromomethyl)-1-propan-2-yl-3,6-dihydro-2H-pyridine (PubChem CID 117205525) has the molecular formula C9H16BrN and a molecular weight of 218.14 g/mol. Its IUPAC name is 4-(bromomethyl)-1-propan-2-yl-3,6-dihydro-2H-pyridine.
| Compound Name | 4-(bromomethyl)-1-propan-2-yl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 117205525 |
| Molecular Formula | C9H16BrN |
| Molecular Weight | 218.14 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | 4-(bromomethyl)-1-propan-2-yl-3,6-dihydro-2H-pyridine |
| SMILES | CC(C)N1CC=C(CBr)CC1 |
| InChI | InChI=1S/C9H16BrN/c1-8(2)11-5-3-9(7-10)4-6-11/h3,8H,4-7H2,1-2H3 |
| InChIKey | LNBBAWFXIDERBG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.14 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|