C12H23N — CID 122599461
4-(2-methylpropyl)-1-propan-2-yl-3,6-dihydro-2H-pyridine (PubChem CID 122599461) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is 4-(2-methylpropyl)-1-propan-2-yl-3,6-dihydro-2H-pyridine.
| Compound Name | 4-(2-methylpropyl)-1-propan-2-yl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 122599461 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | 4-(2-methylpropyl)-1-propan-2-yl-3,6-dihydro-2H-pyridine |
| SMILES | CC(C)CC1=CCN(C(C)C)CC1 |
| InChI | InChI=1S/C12H23N/c1-10(2)9-12-5-7-13(8-6-12)11(3)4/h5,10-11H,6-9H2,1-4H3 |
| InChIKey | YVOCKWFWRQDXMX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|