C10H18FN — CID 178173389
4-(fluoromethyl)-1-propan-2-yl-2,3,6,7-tetrahydroazepine (PubChem CID 178173389) has the molecular formula C10H18FN and a molecular weight of 171.26 g/mol. Its IUPAC name is 4-(fluoromethyl)-1-propan-2-yl-2,3,6,7-tetrahydroazepine.
| Compound Name | 4-(fluoromethyl)-1-propan-2-yl-2,3,6,7-tetrahydroazepine |
|---|---|
| PubChem CID | 178173389 |
| Molecular Formula | C10H18FN |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | 4-(fluoromethyl)-1-propan-2-yl-2,3,6,7-tetrahydroazepine |
| SMILES | CC(C)N1CCC=C(CF)CC1 |
| InChI | InChI=1S/C10H18FN/c1-9(2)12-6-3-4-10(8-11)5-7-12/h4,9H,3,5-8H2,1-2H3 |
| InChIKey | XOSLHTUQGSBHTG-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|