C18H35FN2 — CID 169145735
ethane;4-fluoro-1-methyl-2,3,6,7-tetrahydroazepine;1-propan-2-yl-2,3,6,7-tetrahydroazepine (PubChem CID 169145735) has the molecular formula C18H35FN2 and a molecular weight of 298.49 g/mol. Its IUPAC name is ethane;4-fluoro-1-methyl-2,3,6,7-tetrahydroazepine;1-propan-2-yl-2,3,6,7-tetrahydroazepine.
| Compound Name | ethane;4-fluoro-1-methyl-2,3,6,7-tetrahydroazepine;1-propan-2-yl-2,3,6,7-tetrahydroazepine |
|---|---|
| PubChem CID | 169145735 |
| Molecular Formula | C18H35FN2 |
| Molecular Weight | 298.49 g/mol |
| Exact Mass | 298.28 |
| IUPAC Name | ethane;4-fluoro-1-methyl-2,3,6,7-tetrahydroazepine;1-propan-2-yl-2,3,6,7-tetrahydroazepine |
| SMILES | CC.CC(C)N1CCC=CCC1.CN1CCC=C(F)CC1 |
| InChI | InChI=1S/C9H17N.C7H12FN.C2H6/c1-9(2)10-7-5-3-4-6-8-10;1-9-5-2-3-7(8)4-6-9;1-2/h3-4,9H,5-8H2,1-2H3;3H,2,4-6H2,1H3;1-2H3 |
| InChIKey | QBBYQKRKIAXONB-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.49 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|