About 3-methyl-1-propan-2-yl-4,5-dihydro-2H-1,3-diazepine
3-methyl-1-propan-2-yl-4,5-dihydro-2H-1,3-diazepine (PubChem CID 66910915) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is 3-methyl-1-propan-2-yl-4,5-dihydro-2H-1,3-diazepine.
Analyze 3-methyl-1-propan-2-yl-4,5-dihydro-2H-1,3-diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1-propan-2-yl-4,5-dihydro-2H-1,3-diazepine?
The IUPAC name of 3-methyl-1-propan-2-yl-4,5-dihydro-2H-1,3-diazepine (CID 66910915) is 3-methyl-1-propan-2-yl-4,5-dihydro-2H-1,3-diazepine.
What is the SMILES notation for 3-methyl-1-propan-2-yl-4,5-dihydro-2H-1,3-diazepine?
The canonical SMILES for 3-methyl-1-propan-2-yl-4,5-dihydro-2H-1,3-diazepine is CC(C)N1C=CCCN(C)C1.
What is the InChIKey of 3-methyl-1-propan-2-yl-4,5-dihydro-2H-1,3-diazepine?
The InChIKey is MKTNEGHKCPSVBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2/c1-9(2)11-7-5-4-6-10(3)8-11/h5,7,9H,4,6,8H2,1-3H3.
What are the key properties of 3-methyl-1-propan-2-yl-4,5-dihydro-2H-1,3-diazepine?
3-methyl-1-propan-2-yl-4,5-dihydro-2H-1,3-diazepine has a molecular weight of 154.26 g/mol, XLogP of 1.50, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1-propan-2-yl-4,5-dihydro-2H-1,3-diazepine is sourced from PubChem (CID 66910915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).