C9H17N — CID 89064702
1-(3-methylbutan-2-yl)-2,3-dihydropyrrole (PubChem CID 89064702) has the molecular formula C9H17N and a molecular weight of 139.24 g/mol. Its IUPAC name is 1-(3-methylbutan-2-yl)-2,3-dihydropyrrole.
| Compound Name | 1-(3-methylbutan-2-yl)-2,3-dihydropyrrole |
|---|---|
| PubChem CID | 89064702 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | 1-(3-methylbutan-2-yl)-2,3-dihydropyrrole |
| SMILES | CC(C)C(C)N1C=CCC1 |
| InChI | InChI=1S/C9H17N/c1-8(2)9(3)10-6-4-5-7-10/h4,6,8-9H,5,7H2,1-3H3 |
| InChIKey | YJTGXYJJKACQDG-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |