C16H34N2S — CID 168942708
ethane;1-methyl-3,6-dihydro-2H-pyridine;4-propan-2-yl-1,4-thiazepane (PubChem CID 168942708) has the molecular formula C16H34N2S and a molecular weight of 286.53 g/mol. Its IUPAC name is ethane;1-methyl-3,6-dihydro-2H-pyridine;4-propan-2-yl-1,4-thiazepane.
| Compound Name | ethane;1-methyl-3,6-dihydro-2H-pyridine;4-propan-2-yl-1,4-thiazepane |
|---|---|
| PubChem CID | 168942708 |
| Molecular Formula | C16H34N2S |
| Molecular Weight | 286.53 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | ethane;1-methyl-3,6-dihydro-2H-pyridine;4-propan-2-yl-1,4-thiazepane |
| SMILES | CC.CC(C)N1CCCSCC1.CN1CC=CCC1 |
| InChI | InChI=1S/C8H17NS.C6H11N.C2H6/c1-8(2)9-4-3-6-10-7-5-9;1-7-5-3-2-4-6-7;1-2/h8H,3-7H2,1-2H3;2-3H,4-6H2,1H3;1-2H3 |
| InChIKey | XUDZOTOSIROCAL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.53 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|