About 4-fluorobenzaldehyde;1-methyl-4-propan-2-ylpiperazine
4-fluorobenzaldehyde;1-methyl-4-propan-2-ylpiperazine (PubChem CID 142810039) has the molecular formula C15H23FN2O
and a molecular weight of 266.36 g/mol. Its IUPAC name is 4-fluorobenzaldehyde;1-methyl-4-propan-2-ylpiperazine.
Molecular Properties
| Compound Name | 4-fluorobenzaldehyde;1-methyl-4-propan-2-ylpiperazine |
| PubChem CID | 142810039 |
| Molecular Formula | C15H23FN2O |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 4-fluorobenzaldehyde;1-methyl-4-propan-2-ylpiperazine |
| SMILES | CC(C)N1CCN(C)CC1.O=Cc1ccc(F)cc1 |
| InChI | InChI=1S/C8H18N2.C7H5FO/c1-8(2)10-6-4-9(3)5-7-10;8-7-3-1-6(5-9)2-4-7/h8H,4-7H2,1-3H3;1-5H |
| InChIKey | SPFIMRJIIFECPD-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-fluorobenzaldehyde;1-methyl-4-propan-2-ylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluorobenzaldehyde;1-methyl-4-propan-2-ylpiperazine?
The IUPAC name of 4-fluorobenzaldehyde;1-methyl-4-propan-2-ylpiperazine (CID 142810039) is 4-fluorobenzaldehyde;1-methyl-4-propan-2-ylpiperazine.
What is the SMILES notation for 4-fluorobenzaldehyde;1-methyl-4-propan-2-ylpiperazine?
The canonical SMILES for 4-fluorobenzaldehyde;1-methyl-4-propan-2-ylpiperazine is CC(C)N1CCN(C)CC1.O=Cc1ccc(F)cc1.
What is the InChIKey of 4-fluorobenzaldehyde;1-methyl-4-propan-2-ylpiperazine?
The InChIKey is SPFIMRJIIFECPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2.C7H5FO/c1-8(2)10-6-4-9(3)5-7-10;8-7-3-1-6(5-9)2-4-7/h8H,4-7H2,1-3H3;1-5H.
What are the key properties of 4-fluorobenzaldehyde;1-methyl-4-propan-2-ylpiperazine?
4-fluorobenzaldehyde;1-methyl-4-propan-2-ylpiperazine has a molecular weight of 266.36 g/mol, XLogP of 2.28, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluorobenzaldehyde;1-methyl-4-propan-2-ylpiperazine is sourced from PubChem (CID 142810039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).