C11H23NO2S — CID 144801740
ethane;4-methyl-1-propan-2-ylsulfonyl-3,6-dihydro-2H-pyridine (PubChem CID 144801740) has the molecular formula C11H23NO2S and a molecular weight of 233.38 g/mol. Its IUPAC name is ethane;4-methyl-1-propan-2-ylsulfonyl-3,6-dihydro-2H-pyridine.
| Compound Name | ethane;4-methyl-1-propan-2-ylsulfonyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 144801740 |
| Molecular Formula | C11H23NO2S |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | ethane;4-methyl-1-propan-2-ylsulfonyl-3,6-dihydro-2H-pyridine |
| SMILES | CC.CC1=CCN(S(=O)(=O)C(C)C)CC1 |
| InChI | InChI=1S/C9H17NO2S.C2H6/c1-8(2)13(11,12)10-6-4-9(3)5-7-10;1-2/h4,8H,5-7H2,1-3H3;1-2H3 |
| InChIKey | UPSINBQDRYCXMM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|