C11H21NO2S — CID 144802262
1-cyclopropylsulfonyl-4-methyl-3,6-dihydro-2H-pyridine;ethane (PubChem CID 144802262) has the molecular formula C11H21NO2S and a molecular weight of 231.36 g/mol. Its IUPAC name is 1-cyclopropylsulfonyl-4-methyl-3,6-dihydro-2H-pyridine;ethane.
| Compound Name | 1-cyclopropylsulfonyl-4-methyl-3,6-dihydro-2H-pyridine;ethane |
|---|---|
| PubChem CID | 144802262 |
| Molecular Formula | C11H21NO2S |
| Molecular Weight | 231.36 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 1-cyclopropylsulfonyl-4-methyl-3,6-dihydro-2H-pyridine;ethane |
| SMILES | CC.CC1=CCN(S(=O)(=O)C2CC2)CC1 |
| InChI | InChI=1S/C9H15NO2S.C2H6/c1-8-4-6-10(7-5-8)13(11,12)9-2-3-9;1-2/h4,9H,2-3,5-7H2,1H3;1-2H3 |
| InChIKey | WYIZNOCFHNIXTM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|