C10H16F3NO4S2 — CID 136559716
4-methyl-1-[3-(trifluoromethylsulfonyl)propylsulfonyl]-3,6-dihydro-2H-pyridine (PubChem CID 136559716) has the molecular formula C10H16F3NO4S2 and a molecular weight of 335.37 g/mol. Its IUPAC name is 4-methyl-1-[3-(trifluoromethylsulfonyl)propylsulfonyl]-3,6-dihydro-2H-pyridine.
| Compound Name | 4-methyl-1-[3-(trifluoromethylsulfonyl)propylsulfonyl]-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 136559716 |
| Molecular Formula | C10H16F3NO4S2 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 4-methyl-1-[3-(trifluoromethylsulfonyl)propylsulfonyl]-3,6-dihydro-2H-pyridine |
| SMILES | CC1=CCN(S(=O)(=O)CCCS(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H16F3NO4S2/c1-9-3-5-14(6-4-9)20(17,18)8-2-7-19(15,16)10(11,12)13/h3H,2,4-8H2,1H3 |
| InChIKey | DTJZYMKVJFZSHP-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|