C7H9ClF3NO2S — CID 114490511
1-(chloromethylsulfonyl)-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine (PubChem CID 114490511) has the molecular formula C7H9ClF3NO2S and a molecular weight of 263.67 g/mol. Its IUPAC name is 1-(chloromethylsulfonyl)-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine.
| Compound Name | 1-(chloromethylsulfonyl)-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 114490511 |
| Molecular Formula | C7H9ClF3NO2S |
| Molecular Weight | 263.67 g/mol |
| Exact Mass | 263.00 |
| IUPAC Name | 1-(chloromethylsulfonyl)-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine |
| SMILES | O=S(=O)(CCl)N1CC=C(C(F)(F)F)CC1 |
| InChI | InChI=1S/C7H9ClF3NO2S/c8-5-15(13,14)12-3-1-6(2-4-12)7(9,10)11/h1H,2-5H2 |
| InChIKey | BNRXTCNOVCHZAC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.67 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|