C9H15F3N2 — CID 114490242
1-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]propan-2-amine (PubChem CID 114490242) has the molecular formula C9H15F3N2 and a molecular weight of 208.23 g/mol. Its IUPAC name is 1-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]propan-2-amine.
| Compound Name | 1-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]propan-2-amine |
|---|---|
| PubChem CID | 114490242 |
| Molecular Formula | C9H15F3N2 |
| Molecular Weight | 208.23 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 1-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]propan-2-amine |
| SMILES | CC(N)CN1CC=C(C(F)(F)F)CC1 |
| InChI | InChI=1S/C9H15F3N2/c1-7(13)6-14-4-2-8(3-5-14)9(10,11)12/h2,7H,3-6,13H2,1H3 |
| InChIKey | QREYBVKPAGEMHE-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.23 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|