C14H16F3NO — CID 104930369
(1S)-1-[4-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]phenyl]ethanol (PubChem CID 104930369) has the molecular formula C14H16F3NO and a molecular weight of 271.28 g/mol. Its IUPAC name is (1S)-1-[4-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]phenyl]ethanol.
| Compound Name | (1S)-1-[4-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]phenyl]ethanol |
|---|---|
| PubChem CID | 104930369 |
| Molecular Formula | C14H16F3NO |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | (1S)-1-[4-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]phenyl]ethanol |
| SMILES | C[C@H](O)c1ccc(N2CC=C(C(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C14H16F3NO/c1-10(19)11-2-4-13(5-3-11)18-8-6-12(7-9-18)14(15,16)17/h2-6,10,19H,7-9H2,1H3/t10-/m0/s1 |
| InChIKey | KSJPKPLVLWPKLU-JTQLQIEISA-N |
| XLogP | 3.44 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|