C13H16F3N3 — CID 104930323
(1R)-1-[2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]-4-pyridinyl]ethanamine (PubChem CID 104930323) has the molecular formula C13H16F3N3 and a molecular weight of 271.29 g/mol. Its IUPAC name is (1R)-1-[2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]-4-pyridinyl]ethanamine.
| Compound Name | (1R)-1-[2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]-4-pyridinyl]ethanamine |
|---|---|
| PubChem CID | 104930323 |
| Molecular Formula | C13H16F3N3 |
| Molecular Weight | 271.29 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | (1R)-1-[2-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]-4-pyridinyl]ethanamine |
| SMILES | C[C@@H](N)c1ccnc(N2CC=C(C(F)(F)F)CC2)c1 |
| InChI | InChI=1S/C13H16F3N3/c1-9(17)10-2-5-18-12(8-10)19-6-3-11(4-7-19)13(14,15)16/h2-3,5,8-9H,4,6-7,17H2,1H3/t9-/m1/s1 |
| InChIKey | JFKUYTRUVFJACB-SECBINFHSA-N |
| XLogP | 2.80 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.29 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|