C10H11F3N4 — CID 113338983
3-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]pyrazin-2-amine (PubChem CID 113338983) has the molecular formula C10H11F3N4 and a molecular weight of 244.22 g/mol. Its IUPAC name is 3-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]pyrazin-2-amine.
| Compound Name | 3-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]pyrazin-2-amine |
|---|---|
| PubChem CID | 113338983 |
| Molecular Formula | C10H11F3N4 |
| Molecular Weight | 244.22 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 3-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]pyrazin-2-amine |
| SMILES | Nc1nccnc1N1CC=C(C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H11F3N4/c11-10(12,13)7-1-5-17(6-2-7)9-8(14)15-3-4-16-9/h1,3-4H,2,5-6H2,(H2,14,15) |
| InChIKey | AAIUXQMTAZQPAJ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.22 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|