C12H14F3N3 — CID 114489498
[3-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]-2-pyridinyl]methanamine (PubChem CID 114489498) has the molecular formula C12H14F3N3 and a molecular weight of 257.26 g/mol. Its IUPAC name is [3-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]-2-pyridinyl]methanamine.
| Compound Name | [3-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]-2-pyridinyl]methanamine |
|---|---|
| PubChem CID | 114489498 |
| Molecular Formula | C12H14F3N3 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | [3-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]-2-pyridinyl]methanamine |
| SMILES | NCc1ncccc1N1CC=C(C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H14F3N3/c13-12(14,15)9-3-6-18(7-4-9)11-2-1-5-17-10(11)8-16/h1-3,5H,4,6-8,16H2 |
| InChIKey | WASXJQLVRHUHMP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|