C15H19F3N2S — CID 114489474
[2-ethylsulfanyl-6-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]phenyl]methanamine (PubChem CID 114489474) has the molecular formula C15H19F3N2S and a molecular weight of 316.39 g/mol. Its IUPAC name is [2-ethylsulfanyl-6-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]phenyl]methanamine.
| Compound Name | [2-ethylsulfanyl-6-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]phenyl]methanamine |
|---|---|
| PubChem CID | 114489474 |
| Molecular Formula | C15H19F3N2S |
| Molecular Weight | 316.39 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | [2-ethylsulfanyl-6-[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]phenyl]methanamine |
| SMILES | CCSc1cccc(N2CC=C(C(F)(F)F)CC2)c1CN |
| InChI | InChI=1S/C15H19F3N2S/c1-2-21-14-5-3-4-13(12(14)10-19)20-8-6-11(7-9-20)15(16,17)18/h3-6H,2,7-10,19H2,1H3 |
| InChIKey | GUNCNFGTVDBCFI-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|