C17H26N2S — CID 114459791
[2-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-6-methylsulfanylphenyl]methanamine (PubChem CID 114459791) has the molecular formula C17H26N2S and a molecular weight of 290.48 g/mol. Its IUPAC name is [2-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-6-methylsulfanylphenyl]methanamine.
| Compound Name | [2-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-6-methylsulfanylphenyl]methanamine |
|---|---|
| PubChem CID | 114459791 |
| Molecular Formula | C17H26N2S |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | [2-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-6-methylsulfanylphenyl]methanamine |
| SMILES | CSc1cccc(N2CC=C(C(C)(C)C)CC2)c1CN |
| InChI | InChI=1S/C17H26N2S/c1-17(2,3)13-8-10-19(11-9-13)15-6-5-7-16(20-4)14(15)12-18/h5-8H,9-12,18H2,1-4H3 |
| InChIKey | SHPDHDIULNEEDM-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|