C18H27FN2 — CID 104929007
(1R)-1-[2-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-5-fluoro-4-methylphenyl]ethanamine (PubChem CID 104929007) has the molecular formula C18H27FN2 and a molecular weight of 290.43 g/mol. Its IUPAC name is (1R)-1-[2-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-5-fluoro-4-methylphenyl]ethanamine.
| Compound Name | (1R)-1-[2-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-5-fluoro-4-methylphenyl]ethanamine |
|---|---|
| PubChem CID | 104929007 |
| Molecular Formula | C18H27FN2 |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | (1R)-1-[2-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-5-fluoro-4-methylphenyl]ethanamine |
| SMILES | Cc1cc(N2CC=C(C(C)(C)C)CC2)c([C@@H](C)N)cc1F |
| InChI | InChI=1S/C18H27FN2/c1-12-10-17(15(13(2)20)11-16(12)19)21-8-6-14(7-9-21)18(3,4)5/h6,10-11,13H,7-9,20H2,1-5H3/t13-/m1/s1 |
| InChIKey | HKLDJPVKXUMORD-CYBMUJFWSA-N |
| XLogP | 4.34 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|