C16H23FN2 — CID 102814339
[3-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-5-fluorophenyl]methanamine (PubChem CID 102814339) has the molecular formula C16H23FN2 and a molecular weight of 262.37 g/mol. Its IUPAC name is [3-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-5-fluorophenyl]methanamine.
| Compound Name | [3-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-5-fluorophenyl]methanamine |
|---|---|
| PubChem CID | 102814339 |
| Molecular Formula | C16H23FN2 |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | [3-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-5-fluorophenyl]methanamine |
| SMILES | CC(C)(C)C1=CCN(c2cc(F)cc(CN)c2)CC1 |
| InChI | InChI=1S/C16H23FN2/c1-16(2,3)13-4-6-19(7-5-13)15-9-12(11-18)8-14(17)10-15/h4,8-10H,5-7,11,18H2,1-3H3 |
| InChIKey | QFVVLHPQSDAQCB-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|