C16H23ClN2 — CID 114459794
[4-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-3-chlorophenyl]methanamine (PubChem CID 114459794) has the molecular formula C16H23ClN2 and a molecular weight of 278.83 g/mol. Its IUPAC name is [4-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-3-chlorophenyl]methanamine.
| Compound Name | [4-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-3-chlorophenyl]methanamine |
|---|---|
| PubChem CID | 114459794 |
| Molecular Formula | C16H23ClN2 |
| Molecular Weight | 278.83 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | [4-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-3-chlorophenyl]methanamine |
| SMILES | CC(C)(C)C1=CCN(c2ccc(CN)cc2Cl)CC1 |
| InChI | InChI=1S/C16H23ClN2/c1-16(2,3)13-6-8-19(9-7-13)15-5-4-12(11-18)10-14(15)17/h4-6,10H,7-9,11,18H2,1-3H3 |
| InChIKey | MXWICCNMPNEQPW-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.83 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|