C16H20ClNO2 — CID 114460457
2-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-6-chlorobenzoic acid (PubChem CID 114460457) has the molecular formula C16H20ClNO2 and a molecular weight of 293.79 g/mol. Its IUPAC name is 2-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-6-chlorobenzoic acid.
| Compound Name | 2-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-6-chlorobenzoic acid |
|---|---|
| PubChem CID | 114460457 |
| Molecular Formula | C16H20ClNO2 |
| Molecular Weight | 293.79 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 2-(4-tert-butyl-3,6-dihydro-2H-pyridin-1-yl)-6-chlorobenzoic acid |
| SMILES | CC(C)(C)C1=CCN(c2cccc(Cl)c2C(=O)O)CC1 |
| InChI | InChI=1S/C16H20ClNO2/c1-16(2,3)11-7-9-18(10-8-11)13-6-4-5-12(17)14(13)15(19)20/h4-7H,8-10H2,1-3H3,(H,19,20) |
| InChIKey | MQVRETDNPPZGJE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.79 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|